C20H19F3N4O4S — CID 55947329
N-(1-benzylpyrazol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide (PubChem CID 55947329) has the molecular formula C20H19F3N4O4S and a molecular weight of 468.46 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55947329 |
| Molecular Formula | C20H19F3N4O4S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)Nc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H19F3N4O4S/c21-20(22,23)31-17-6-8-18(9-7-17)32(29,30)25-11-10-19(28)26-16-12-24-27(14-16)13-15-4-2-1-3-5-15/h1-9,12,14,25H,10-11,13H2,(H,26,28) |
| InChIKey | GZVWZPJHUQKFJG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |