C18H19F3N2O4S — CID 78768135
N-(3-phenylpropyl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide (PubChem CID 78768135) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(3-phenylpropyl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 78768135 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(3-phenylpropyl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H19F3N2O4S/c19-18(20,21)27-15-8-10-16(11-9-15)28(25,26)23-13-17(24)22-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,23H,4,7,12-13H2,(H,22,24) |
| InChIKey | QTQCPCOPPUINMH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|