C16H16F3NO3S — CID 31687969
N-(3-phenylpropyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 31687969) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is N-(3-phenylpropyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-phenylpropyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 31687969 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(3-phenylpropyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCc1ccccc1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NO3S/c17-16(18,19)23-14-9-4-10-15(12-14)24(21,22)20-11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,12,20H,5,8,11H2 |
| InChIKey | YNQYZBQKTFNKFT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|