C16H23F3N2O3S — CID 47034075
N-[3-(3-methylpiperidin-1-yl)propyl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 47034075) has the molecular formula C16H23F3N2O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 47034075 |
| Molecular Formula | C16H23F3N2O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC1CCCN(CCCNS(=O)(=O)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H23F3N2O3S/c1-13-5-3-9-21(12-13)10-4-8-20-25(22,23)15-7-2-6-14(11-15)24-16(17,18)19/h2,6-7,11,13,20H,3-5,8-10,12H2,1H3 |
| InChIKey | XLKJITXBUFJLQH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|