C11H16ClF3N2O3S — CID 119965033
N-[3-(methylamino)propyl]-3-(trifluoromethoxy)benzenesulfonamide;hydrochloride (PubChem CID 119965033) has the molecular formula C11H16ClF3N2O3S and a molecular weight of 348.77 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-3-(trifluoromethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-3-(trifluoromethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119965033 |
| Molecular Formula | C11H16ClF3N2O3S |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[3-(methylamino)propyl]-3-(trifluoromethoxy)benzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1cccc(OC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H15F3N2O3S.ClH/c1-15-6-3-7-16-20(17,18)10-5-2-4-9(8-10)19-11(12,13)14;/h2,4-5,8,15-16H,3,6-7H2,1H3;1H |
| InChIKey | BQXUYRYCVLWZAO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|