C12H21ClN2O3S — CID 119964995
3-(methoxymethyl)-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride (PubChem CID 119964995) has the molecular formula C12H21ClN2O3S and a molecular weight of 308.83 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-(methoxymethyl)-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119964995 |
| Molecular Formula | C12H21ClN2O3S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(methoxymethyl)-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1cccc(COC)c1.Cl |
| InChI | InChI=1S/C12H20N2O3S.ClH/c1-13-7-4-8-14-18(15,16)12-6-3-5-11(9-12)10-17-2;/h3,5-6,9,13-14H,4,7-8,10H2,1-2H3;1H |
| InChIKey | SXBOGFGQDDJRLV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|