C10H15ClN2O2S — CID 43605915
3-chloro-N-[3-(methylamino)propyl]benzenesulfonamide (PubChem CID 43605915) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 3-chloro-N-[3-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43605915 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-chloro-N-[3-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNCCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2O2S/c1-12-6-3-7-13-16(14,15)10-5-2-4-9(11)8-10/h2,4-5,8,12-13H,3,6-7H2,1H3 |
| InChIKey | HHTIUTVAENKHAX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|