C9H10F3NO3S — CID 43243258
N-ethyl-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 43243258) has the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. Its IUPAC name is N-ethyl-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-ethyl-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43243258 |
| Molecular Formula | C9H10F3NO3S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N-ethyl-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3NO3S/c1-2-13-17(14,15)8-5-3-4-7(6-8)16-9(10,11)12/h3-6,13H,2H2,1H3 |
| InChIKey | MSAKUSOTXODEMA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |