C15H14F3NO3S — CID 31669223
N-(2,5-dimethylphenyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 31669223) has the molecular formula C15H14F3NO3S and a molecular weight of 345.34 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 31669223 |
| Molecular Formula | C15H14F3NO3S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H14F3NO3S/c1-10-6-7-11(2)14(8-10)19-23(20,21)13-5-3-4-12(9-13)22-15(16,17)18/h3-9,19H,1-2H3 |
| InChIKey | DEZDOEAGCALRLE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |