C12H8F4N2O3S — CID 122135835
N-(3-fluoro-4-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 122135835) has the molecular formula C12H8F4N2O3S and a molecular weight of 336.27 g/mol. Its IUPAC name is N-(3-fluoro-4-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-fluoro-4-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 122135835 |
| Molecular Formula | C12H8F4N2O3S |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-(3-fluoro-4-pyridinyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccncc1F)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F4N2O3S/c13-10-7-17-5-4-11(10)18-22(19,20)9-3-1-2-8(6-9)21-12(14,15)16/h1-7H,(H,17,18) |
| InChIKey | CXLOKMJSGPBSDD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |