C19H14F4N2O5S2 — CID 24662739
N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 24662739) has the molecular formula C19H14F4N2O5S2 and a molecular weight of 490.46 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 24662739 |
| Molecular Formula | C19H14F4N2O5S2 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | N-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NS(=O)(=O)c2cccc(OC(F)(F)F)c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14F4N2O5S2/c20-13-4-10-17(11-5-13)31(26,27)24-14-6-8-15(9-7-14)25-32(28,29)18-3-1-2-16(12-18)30-19(21,22)23/h1-12,24-25H |
| InChIKey | IQTGRHYOHPUFHK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|