C15H10F3NO3S — CID 31783498
N-(3-ethynylphenyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 31783498) has the molecular formula C15H10F3NO3S and a molecular weight of 341.31 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-ethynylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 31783498 |
| Molecular Formula | C15H10F3NO3S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(3-ethynylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | C#Cc1cccc(NS(=O)(=O)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H10F3NO3S/c1-2-11-5-3-6-12(9-11)19-23(20,21)14-8-4-7-13(10-14)22-15(16,17)18/h1,3-10,19H |
| InChIKey | WMTJOJUOENOPMQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|