C15H14F3NO3S — CID 17154312
N-(4-ethylphenyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 17154312) has the molecular formula C15H14F3NO3S and a molecular weight of 345.34 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(4-ethylphenyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 17154312 |
| Molecular Formula | C15H14F3NO3S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(4-ethylphenyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H14F3NO3S/c1-2-11-3-5-12(6-4-11)19-23(20,21)14-9-7-13(8-10-14)22-15(16,17)18/h3-10,19H,2H2,1H3 |
| InChIKey | UCCRPUOOSSCQBB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |