C18H17F6NO4S — CID 22203492
N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-ethylbenzenesulfonamide (PubChem CID 22203492) has the molecular formula C18H17F6NO4S and a molecular weight of 457.39 g/mol. Its IUPAC name is N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22203492 |
| Molecular Formula | C18H17F6NO4S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H17F6NO4S/c1-2-12-3-5-16(6-4-12)30(26,27)25-13-7-14(28-10-17(19,20)21)9-15(8-13)29-11-18(22,23)24/h3-9,25H,2,10-11H2,1H3 |
| InChIKey | YIDBOEFKVMXQPC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |