C15H14F3NO2S — CID 118346578
N-(3-ethylphenyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 118346578) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is N-(3-ethylphenyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-ethylphenyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118346578 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(3-ethylphenyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCc1cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H14F3NO2S/c1-2-11-4-3-5-13(10-11)19-22(20,21)14-8-6-12(7-9-14)15(16,17)18/h3-10,19H,2H2,1H3 |
| InChIKey | QYWDTDIMZHZXOW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |