C14H12F3NO4S2 — CID 8842839
N-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 8842839) has the molecular formula C14H12F3NO4S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8842839 |
| Molecular Formula | C14H12F3NO4S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C14H12F3NO4S2/c1-23(19,20)13-4-2-3-11(9-13)18-24(21,22)12-7-5-10(6-8-12)14(15,16)17/h2-9,18H,1H3 |
| InChIKey | JFPGBHMCCRVQFX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |