C13H11NO10S4-2 — CID 176777217
5-[(3-methylsulfonylphenyl)sulfonylamino]benzene-1,3-disulfonate (PubChem CID 176777217) has the molecular formula C13H11NO10S4-2 and a molecular weight of 469.50 g/mol. Its IUPAC name is 5-[(3-methylsulfonylphenyl)sulfonylamino]benzene-1,3-disulfonate.
| Compound Name | 5-[(3-methylsulfonylphenyl)sulfonylamino]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 176777217 |
| Molecular Formula | C13H11NO10S4-2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 468.93 |
| IUPAC Name | 5-[(3-methylsulfonylphenyl)sulfonylamino]benzene-1,3-disulfonate |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)Nc2cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C13H13NO10S4/c1-25(15,16)10-3-2-4-11(7-10)26(17,18)14-9-5-12(27(19,20)21)8-13(6-9)28(22,23)24/h2-8,14H,1H3,(H,19,20,21)(H,22,23,24)/p-2 |
| InChIKey | PLILPUVUNRDADV-UHFFFAOYSA-L |
| XLogP | -0.30 |
| TPSA | 194.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|