C16H18N2O6S2 — CID 8842812
N-[2-methoxy-4-[(3-methylsulfonylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 8842812) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[2-methoxy-4-[(3-methylsulfonylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-methoxy-4-[(3-methylsulfonylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8842812 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[2-methoxy-4-[(3-methylsulfonylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(S(=O)(=O)Nc2cccc(S(C)(=O)=O)c2)ccc1NC(C)=O |
| InChI | InChI=1S/C16H18N2O6S2/c1-11(19)17-15-8-7-14(10-16(15)24-2)26(22,23)18-12-5-4-6-13(9-12)25(3,20)21/h4-10,18H,1-3H3,(H,17,19) |
| InChIKey | FBANNBWFHTZYNZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |