C13H14N2O6S2 — CID 54467936
3-[(4-amino-3-methoxyphenyl)sulfonylamino]benzenesulfonic acid (PubChem CID 54467936) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[(4-amino-3-methoxyphenyl)sulfonylamino]benzenesulfonic acid.
| Compound Name | 3-[(4-amino-3-methoxyphenyl)sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 54467936 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[(4-amino-3-methoxyphenyl)sulfonylamino]benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)Nc2cccc(S(=O)(=O)O)c2)ccc1N |
| InChI | InChI=1S/C13H14N2O6S2/c1-21-13-8-10(5-6-12(13)14)22(16,17)15-9-3-2-4-11(7-9)23(18,19)20/h2-8,15H,14H2,1H3,(H,18,19,20) |
| InChIKey | XGHBLGWOTOKXRQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|