C17H16N2O4S — CID 143837185
6-(4-amino-3-methoxyanilino)naphthalene-2-sulfonic acid (PubChem CID 143837185) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 6-(4-amino-3-methoxyanilino)naphthalene-2-sulfonic acid.
| Compound Name | 6-(4-amino-3-methoxyanilino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143837185 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 6-(4-amino-3-methoxyanilino)naphthalene-2-sulfonic acid |
| SMILES | COc1cc(Nc2ccc3cc(S(=O)(=O)O)ccc3c2)ccc1N |
| InChI | InChI=1S/C17H16N2O4S/c1-23-17-10-14(5-7-16(17)18)19-13-4-2-12-9-15(24(20,21)22)6-3-11(12)8-13/h2-10,19H,18H2,1H3,(H,20,21,22) |
| InChIKey | WXEHOZYFVLNEGC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|