C14H18N2O7S2 — CID 19877100
3-amino-4-methoxybenzenesulfonic acid;3-amino-4-methylbenzenesulfonic acid (PubChem CID 19877100) has the molecular formula C14H18N2O7S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-amino-4-methoxybenzenesulfonic acid;3-amino-4-methylbenzenesulfonic acid.
| Compound Name | 3-amino-4-methoxybenzenesulfonic acid;3-amino-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19877100 |
| Molecular Formula | C14H18N2O7S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 3-amino-4-methoxybenzenesulfonic acid;3-amino-4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)cc1N.Cc1ccc(S(=O)(=O)O)cc1N |
| InChI | InChI=1S/C7H9NO4S.C7H9NO3S/c1-12-7-3-2-5(4-6(7)8)13(9,10)11;1-5-2-3-6(4-7(5)8)12(9,10)11/h2-4H,8H2,1H3,(H,9,10,11);2-4H,8H2,1H3,(H,9,10,11) |
| InChIKey | IYXNAKLTUXVXSC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|