3-amino-4-(4-methylphenoxy)benzenesulfonic acid

C13H13NO4S — CID 141233792

IUPAC3-amino-4-(4-methylphenoxy)benzenesulfonic acid
SMILESCc1ccc(Oc2ccc(S(=O)(=O)O)cc2N)cc1
InChIInChI=1S/C13H13NO4S/c1-9-2-4-10(5-3-9)18-13-7-6-11(8-12(13)14)19(15,16)17/h2-8H,14H2,1H3,(H,15,16,17)
InChIKeyNHAYKVJFBONDIU-UHFFFAOYSA-N
MW279.32 g/mol
LogP2.62
Rot. Bonds3

About 3-amino-4-(4-methylphenoxy)benzenesulfonic acid

3-amino-4-(4-methylphenoxy)benzenesulfonic acid (PubChem CID 141233792) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-amino-4-(4-methylphenoxy)benzenesulfonic acid.

Molecular Properties

Compound Name3-amino-4-(4-methylphenoxy)benzenesulfonic acid
PubChem CID141233792
Molecular FormulaC13H13NO4S
Molecular Weight279.32 g/mol
Exact Mass279.06
IUPAC Name3-amino-4-(4-methylphenoxy)benzenesulfonic acid
SMILESCc1ccc(Oc2ccc(S(=O)(=O)O)cc2N)cc1
InChIInChI=1S/C13H13NO4S/c1-9-2-4-10(5-3-9)18-13-7-6-11(8-12(13)14)19(15,16)17/h2-8H,14H2,1H3,(H,15,16,17)
InChIKeyNHAYKVJFBONDIU-UHFFFAOYSA-N
XLogP2.62
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.32
LogP ≤ 52.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-amino-4-(4-methylphenoxy)benzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-amino-4-(2-methylphenoxy)benzenesulfonic acid
CID 18959894
3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen
CID 175429232
3-amino-4-methoxybenzenesulfonic acid;3-amino-4-methylbenzenesulfonic acid
CID 19877100
2,5-bis[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid
CID 58944105
3-amino-4-(4-methylsulfonylphenoxy)benzoic acid
CID 60987365
3-amino-4-(2-methylpropoxy)benzenesulfonic acid
CID 21223116
4-[5-methyl-2-(4-methyl-2-phenoxyphenyl)phenoxy]benzenesulfonic acid
CID 164811242
2-(4-ethylphenoxy)-5-methylsulfonylaniline
CID 43448142
5-methylsulfonyl-2-(4-propan-2-ylphenoxy)aniline
CID 43448136
methanol;4-methylbenzenesulfonic acid;nickel
CID 162157785
4-methylbenzenesulfonic acid
CID 157221593
5-methylsulfonyl-2-[4-(trifluoromethoxy)phenoxy]aniline
CID 167530156

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-(4-methylphenoxy)benzenesulfonic acid?
The IUPAC name of 3-amino-4-(4-methylphenoxy)benzenesulfonic acid (CID 141233792) is 3-amino-4-(4-methylphenoxy)benzenesulfonic acid.
What is the SMILES notation for 3-amino-4-(4-methylphenoxy)benzenesulfonic acid?
The canonical SMILES for 3-amino-4-(4-methylphenoxy)benzenesulfonic acid is Cc1ccc(Oc2ccc(S(=O)(=O)O)cc2N)cc1.
What is the InChIKey of 3-amino-4-(4-methylphenoxy)benzenesulfonic acid?
The InChIKey is NHAYKVJFBONDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-9-2-4-10(5-3-9)18-13-7-6-11(8-12(13)14)19(15,16)17/h2-8H,14H2,1H3,(H,15,16,17).
What are the key properties of 3-amino-4-(4-methylphenoxy)benzenesulfonic acid?
3-amino-4-(4-methylphenoxy)benzenesulfonic acid has a molecular weight of 279.32 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(4-methylphenoxy)benzenesulfonic acid is sourced from PubChem (CID 141233792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).