C10H15NO4S — CID 21223116
3-amino-4-(2-methylpropoxy)benzenesulfonic acid (PubChem CID 21223116) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-amino-4-(2-methylpropoxy)benzenesulfonic acid.
| Compound Name | 3-amino-4-(2-methylpropoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 21223116 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-amino-4-(2-methylpropoxy)benzenesulfonic acid |
| SMILES | CC(C)COc1ccc(S(=O)(=O)O)cc1N |
| InChI | InChI=1S/C10H15NO4S/c1-7(2)6-15-10-4-3-8(5-9(10)11)16(12,13)14/h3-5,7H,6,11H2,1-2H3,(H,12,13,14) |
| InChIKey | REWXSGUDVDFHCQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|