About 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen
3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen (PubChem CID 175429232) has the molecular formula C7H9N3O4S
and a molecular weight of 231.23 g/mol. Its IUPAC name is 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen.
Molecular Properties
| Compound Name | 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen |
| PubChem CID | 175429232 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen |
| SMILES | COc1ccc(S(=O)(=O)O)cc1N.N#N |
| InChI | InChI=1S/C7H9NO4S.N2/c1-12-7-3-2-5(4-6(7)8)13(9,10)11;1-2/h2-4H,8H2,1H3,(H,9,10,11); |
| InChIKey | QAYHCECTBLPUAJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen?
The IUPAC name of 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen (CID 175429232) is 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen.
What is the SMILES notation for 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen?
The canonical SMILES for 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen is COc1ccc(S(=O)(=O)O)cc1N.N#N.
What is the InChIKey of 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen?
The InChIKey is QAYHCECTBLPUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4S.N2/c1-12-7-3-2-5(4-6(7)8)13(9,10)11;1-2/h2-4H,8H2,1H3,(H,9,10,11);.
What are the key properties of 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen?
3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen has a molecular weight of 231.23 g/mol, XLogP of 0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methoxybenzenesulfonic acid;molecular nitrogen is sourced from PubChem (CID 175429232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).