C32H26O9S3 — CID 58944105
2,5-bis[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid (PubChem CID 58944105) has the molecular formula C32H26O9S3 and a molecular weight of 650.75 g/mol. Its IUPAC name is 2,5-bis[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid.
| Compound Name | 2,5-bis[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 58944105 |
| Molecular Formula | C32H26O9S3 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 2,5-bis[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(Oc4ccc(S(=O)(=O)c5ccc(C)cc5)cc4)c(S(=O)(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C32H26O9S3/c1-22-3-12-27(13-4-22)42(33,34)29-16-7-24(8-17-29)40-26-11-20-31(32(21-26)44(37,38)39)41-25-9-18-30(19-10-25)43(35,36)28-14-5-23(2)6-15-28/h3-21H,1-2H3,(H,37,38,39) |
| InChIKey | BNSBPLQTYWRVAZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|