C26H22O7S2 — CID 135215271
5-(4-methoxyphenyl)-2-[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid (PubChem CID 135215271) has the molecular formula C26H22O7S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid.
| Compound Name | 5-(4-methoxyphenyl)-2-[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 135215271 |
| Molecular Formula | C26H22O7S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-[4-(4-methylphenyl)sulfonylphenoxy]benzenesulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)cc4)cc3)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C26H22O7S2/c1-18-3-12-23(13-4-18)34(27,28)24-14-10-22(11-15-24)33-25-16-7-20(17-26(25)35(29,30)31)19-5-8-21(32-2)9-6-19/h3-17H,1-2H3,(H,29,30,31) |
| InChIKey | YCECXMKJOPNUTC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|