C32H34O9S3 — CID 89065484
2-tert-butyl-5-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]-3-sulfophenyl]benzenesulfonic acid (PubChem CID 89065484) has the molecular formula C32H34O9S3 and a molecular weight of 658.82 g/mol. Its IUPAC name is 2-tert-butyl-5-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]-3-sulfophenyl]benzenesulfonic acid.
| Compound Name | 2-tert-butyl-5-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]-3-sulfophenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89065484 |
| Molecular Formula | C32H34O9S3 |
| Molecular Weight | 658.82 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | 2-tert-butyl-5-[4-[4-(4-tert-butylphenyl)sulfonylphenoxy]-3-sulfophenyl]benzenesulfonic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)c2ccc(Oc3ccc(-c4ccc(C(C)(C)C)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H34O9S3/c1-31(2,3)23-9-13-25(14-10-23)42(33,34)26-15-11-24(12-16-26)41-28-18-8-22(20-30(28)44(38,39)40)21-7-17-27(32(4,5)6)29(19-21)43(35,36)37/h7-20H,1-6H3,(H,35,36,37)(H,38,39,40) |
| InChIKey | QERYRODOYQLJNV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|