C34H38O16S5 — CID 89042654
2-[4-(4-tert-butyl-3-sulfophenyl)sulfonyl-2-sulfophenoxy]-5-[2-(4-propan-2-yloxy-3-sulfophenyl)propan-2-yl]benzenesulfonic acid (PubChem CID 89042654) has the molecular formula C34H38O16S5 and a molecular weight of 863.00 g/mol. Its IUPAC name is 2-[4-(4-tert-butyl-3-sulfophenyl)sulfonyl-2-sulfophenoxy]-5-[2-(4-propan-2-yloxy-3-sulfophenyl)propan-2-yl]benzenesulfonic acid.
| Compound Name | 2-[4-(4-tert-butyl-3-sulfophenyl)sulfonyl-2-sulfophenoxy]-5-[2-(4-propan-2-yloxy-3-sulfophenyl)propan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89042654 |
| Molecular Formula | C34H38O16S5 |
| Molecular Weight | 863.00 g/mol |
| Exact Mass | 862.08 |
| IUPAC Name | 2-[4-(4-tert-butyl-3-sulfophenyl)sulfonyl-2-sulfophenoxy]-5-[2-(4-propan-2-yloxy-3-sulfophenyl)propan-2-yl]benzenesulfonic acid |
| SMILES | CC(C)Oc1ccc(C(C)(C)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)C)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C34H38O16S5/c1-20(2)49-26-13-8-21(16-30(26)53(40,41)42)34(6,7)22-9-14-27(31(17-22)54(43,44)45)50-28-15-11-24(19-32(28)55(46,47)48)51(35,36)23-10-12-25(33(3,4)5)29(18-23)52(37,38)39/h8-20H,1-7H3,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48) |
| InChIKey | JMBOQTWOACGSQA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 270.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.00 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|