C13H12O9S3 — CID 89324954
2-methoxy-5-(3-sulfophenyl)sulfonylbenzenesulfonic acid (PubChem CID 89324954) has the molecular formula C13H12O9S3 and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-methoxy-5-(3-sulfophenyl)sulfonylbenzenesulfonic acid.
| Compound Name | 2-methoxy-5-(3-sulfophenyl)sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89324954 |
| Molecular Formula | C13H12O9S3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 2-methoxy-5-(3-sulfophenyl)sulfonylbenzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)c2cccc(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H12O9S3/c1-22-12-6-5-10(8-13(12)25(19,20)21)23(14,15)9-3-2-4-11(7-9)24(16,17)18/h2-8H,1H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | MNNKYOYFPPQQMO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|