C24H18O14S5 — CID 89107671
3-[2-hydroxy-5-[4-hydroxy-3-(3-sulfophenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzenesulfonic acid (PubChem CID 89107671) has the molecular formula C24H18O14S5 and a molecular weight of 690.73 g/mol. Its IUPAC name is 3-[2-hydroxy-5-[4-hydroxy-3-(3-sulfophenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 3-[2-hydroxy-5-[4-hydroxy-3-(3-sulfophenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89107671 |
| Molecular Formula | C24H18O14S5 |
| Molecular Weight | 690.73 g/mol |
| Exact Mass | 689.93 |
| IUPAC Name | 3-[2-hydroxy-5-[4-hydroxy-3-(3-sulfophenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccc(O)c(S(=O)(=O)c4cccc(S(=O)(=O)O)c4)c3)ccc2O)c1 |
| InChI | InChI=1S/C24H18O14S5/c25-21-9-7-17(13-23(21)40(29,30)15-3-1-5-19(11-15)42(33,34)35)39(27,28)18-8-10-22(26)24(14-18)41(31,32)16-4-2-6-20(12-16)43(36,37)38/h1-14,25-26H,(H,33,34,35)(H,36,37,38) |
| InChIKey | XFEJFEQJNZUYIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 251.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|