C14H16N2O8S2 — CID 88634549
4-hydroxy-3-[2-(2-hydroxy-5-sulfoanilino)ethylamino]benzenesulfonic acid (PubChem CID 88634549) has the molecular formula C14H16N2O8S2 and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-hydroxy-3-[2-(2-hydroxy-5-sulfoanilino)ethylamino]benzenesulfonic acid.
| Compound Name | 4-hydroxy-3-[2-(2-hydroxy-5-sulfoanilino)ethylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 88634549 |
| Molecular Formula | C14H16N2O8S2 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 4-hydroxy-3-[2-(2-hydroxy-5-sulfoanilino)ethylamino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(O)c(NCCNc2cc(S(=O)(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C14H16N2O8S2/c17-13-3-1-9(25(19,20)21)7-11(13)15-5-6-16-12-8-10(26(22,23)24)2-4-14(12)18/h1-4,7-8,15-18H,5-6H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | FNYLTGRVCYRVJL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|