C7H9NO8S3 — CID 89385930
2-(methanesulfonamido)benzene-1,4-disulfonic acid (PubChem CID 89385930) has the molecular formula C7H9NO8S3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 2-(methanesulfonamido)benzene-1,4-disulfonic acid.
| Compound Name | 2-(methanesulfonamido)benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 89385930 |
| Molecular Formula | C7H9NO8S3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 2-(methanesulfonamido)benzene-1,4-disulfonic acid |
| SMILES | CS(=O)(=O)Nc1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C7H9NO8S3/c1-17(9,10)8-6-4-5(18(11,12)13)2-3-7(6)19(14,15)16/h2-4,8H,1H3,(H,11,12,13)(H,14,15,16) |
| InChIKey | MYKFTGKGVJFGOX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|