C8H10O6S2 — CID 57045221
2-ethylbenzene-1,4-disulfonic acid (PubChem CID 57045221) has the molecular formula C8H10O6S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-ethylbenzene-1,4-disulfonic acid.
| Compound Name | 2-ethylbenzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 57045221 |
| Molecular Formula | C8H10O6S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-ethylbenzene-1,4-disulfonic acid |
| SMILES | CCc1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C8H10O6S2/c1-2-6-5-7(15(9,10)11)3-4-8(6)16(12,13)14/h3-5H,2H2,1H3,(H,9,10,11)(H,12,13,14) |
| InChIKey | PISVRZXMVTYTGA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|