C15H20N4O9S3 — CID 159369200
2-[[4-(ethylamino)-6-propyl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid;sulfur trioxide (PubChem CID 159369200) has the molecular formula C15H20N4O9S3 and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[[4-(ethylamino)-6-propyl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid;sulfur trioxide.
| Compound Name | 2-[[4-(ethylamino)-6-propyl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 159369200 |
| Molecular Formula | C15H20N4O9S3 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 2-[[4-(ethylamino)-6-propyl-1,3,5-triazin-2-yl]methyl]benzene-1,4-disulfonic acid;sulfur trioxide |
| SMILES | CCCc1nc(Cc2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)nc(NCC)n1.O=S(=O)=O |
| InChI | InChI=1S/C15H20N4O6S2.O3S/c1-3-5-13-17-14(19-15(18-13)16-4-2)9-10-8-11(26(20,21)22)6-7-12(10)27(23,24)25;1-4(2)3/h6-8H,3-5,9H2,1-2H3,(H,20,21,22)(H,23,24,25)(H,16,17,18,19); |
| InChIKey | LJNGPWVXFMKTRX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 210.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|