C13H15NaO3S — CID 173430311
sodium;hydride;4-propylnaphthalene-2-sulfonic acid (PubChem CID 173430311) has the molecular formula C13H15NaO3S and a molecular weight of 274.32 g/mol. Its IUPAC name is sodium;hydride;4-propylnaphthalene-2-sulfonic acid.
| Compound Name | sodium;hydride;4-propylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 173430311 |
| Molecular Formula | C13H15NaO3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | sodium;hydride;4-propylnaphthalene-2-sulfonic acid |
| SMILES | CCCc1cc(S(=O)(=O)O)cc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C13H14O3S.Na.H/c1-2-5-10-8-12(17(14,15)16)9-11-6-3-4-7-13(10)11;;/h3-4,6-9H,2,5H2,1H3,(H,14,15,16);;/q;+1;-1 |
| InChIKey | DJHIDOBGFCNTDI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|