C16H20O3S — CID 101323866
3,4-dipropylnaphthalene-2-sulfonic acid (PubChem CID 101323866) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3,4-dipropylnaphthalene-2-sulfonic acid.
| Compound Name | 3,4-dipropylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 101323866 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3,4-dipropylnaphthalene-2-sulfonic acid |
| SMILES | CCCc1c(S(=O)(=O)O)cc2ccccc2c1CCC |
| InChI | InChI=1S/C16H20O3S/c1-3-7-14-13-10-6-5-9-12(13)11-16(20(17,18)19)15(14)8-4-2/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | AYORRQOBNNONDR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|