C18H16Na2O6S2+2 — CID 133065597
disodium;2-(2-phenylethyl)naphthalene-1,3-disulfonic acid (PubChem CID 133065597) has the molecular formula C18H16Na2O6S2+2 and a molecular weight of 438.43 g/mol. Its IUPAC name is disodium;2-(2-phenylethyl)naphthalene-1,3-disulfonic acid.
| Compound Name | disodium;2-(2-phenylethyl)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 133065597 |
| Molecular Formula | C18H16Na2O6S2+2 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | disodium;2-(2-phenylethyl)naphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc2ccccc2c(S(=O)(=O)O)c1CCc1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H16O6S2.2Na/c19-25(20,21)17-12-14-8-4-5-9-15(14)18(26(22,23)24)16(17)11-10-13-6-2-1-3-7-13;;/h1-9,12H,10-11H2,(H,19,20,21)(H,22,23,24);;/q;2*+1 |
| InChIKey | ARGLDJXMOMAQEN-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|