C23H34O4S — CID 130237556
2,3-dihexylnaphthalene-1-sulfonic acid;formaldehyde (PubChem CID 130237556) has the molecular formula C23H34O4S and a molecular weight of 406.59 g/mol. Its IUPAC name is 2,3-dihexylnaphthalene-1-sulfonic acid;formaldehyde.
| Compound Name | 2,3-dihexylnaphthalene-1-sulfonic acid;formaldehyde |
|---|---|
| PubChem CID | 130237556 |
| Molecular Formula | C23H34O4S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2,3-dihexylnaphthalene-1-sulfonic acid;formaldehyde |
| SMILES | C=O.CCCCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCCCC |
| InChI | InChI=1S/C22H32O3S.CH2O/c1-3-5-7-9-13-18-17-19-14-11-12-16-21(19)22(26(23,24)25)20(18)15-10-8-6-4-2;1-2/h11-12,14,16-17H,3-10,13,15H2,1-2H3,(H,23,24,25);1H2 |
| InChIKey | IOGPHPCXJIFUJP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|