C32H55NO3S — CID 173222195
2,3-di(nonyl)naphthalene-1-sulfonic acid;N-ethylethanamine (PubChem CID 173222195) has the molecular formula C32H55NO3S and a molecular weight of 533.86 g/mol. Its IUPAC name is 2,3-di(nonyl)naphthalene-1-sulfonic acid;N-ethylethanamine.
| Compound Name | 2,3-di(nonyl)naphthalene-1-sulfonic acid;N-ethylethanamine |
|---|---|
| PubChem CID | 173222195 |
| Molecular Formula | C32H55NO3S |
| Molecular Weight | 533.86 g/mol |
| Exact Mass | 533.39 |
| IUPAC Name | 2,3-di(nonyl)naphthalene-1-sulfonic acid;N-ethylethanamine |
| SMILES | CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCCCCCCC.CCNCC |
| InChI | InChI=1S/C28H44O3S.C4H11N/c1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2;1-3-5-4-2/h17-18,20,22-23H,3-16,19,21H2,1-2H3,(H,29,30,31);5H,3-4H2,1-2H3 |
| InChIKey | YSUMVDHZOBQTII-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.86 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|