C34H59NO3S — CID 138400443
azane;2,3-bis(10-methylundecyl)naphthalene-1-sulfonic acid (PubChem CID 138400443) has the molecular formula C34H59NO3S and a molecular weight of 561.92 g/mol. Its IUPAC name is azane;2,3-bis(10-methylundecyl)naphthalene-1-sulfonic acid.
| Compound Name | azane;2,3-bis(10-methylundecyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 138400443 |
| Molecular Formula | C34H59NO3S |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 561.42 |
| IUPAC Name | azane;2,3-bis(10-methylundecyl)naphthalene-1-sulfonic acid |
| SMILES | CC(C)CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCCCCCCCC(C)C.N |
| InChI | InChI=1S/C34H56O3S.H3N/c1-28(2)21-15-11-7-5-9-13-17-23-30-27-31-24-19-20-26-33(31)34(38(35,36)37)32(30)25-18-14-10-6-8-12-16-22-29(3)4;/h19-20,24,26-29H,5-18,21-23,25H2,1-4H3,(H,35,36,37);1H3 |
| InChIKey | AKISBDVNSUUEIB-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|