C34H60N2O3S — CID 87528492
2,3-di(nonyl)naphthalene-1-sulfonic acid;2-methylpentane-1,1-diamine (PubChem CID 87528492) has the molecular formula C34H60N2O3S and a molecular weight of 576.93 g/mol. Its IUPAC name is 2,3-di(nonyl)naphthalene-1-sulfonic acid;2-methylpentane-1,1-diamine.
| Compound Name | 2,3-di(nonyl)naphthalene-1-sulfonic acid;2-methylpentane-1,1-diamine |
|---|---|
| PubChem CID | 87528492 |
| Molecular Formula | C34H60N2O3S |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 576.43 |
| IUPAC Name | 2,3-di(nonyl)naphthalene-1-sulfonic acid;2-methylpentane-1,1-diamine |
| SMILES | CCCC(C)C(N)N.CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCCCCCCC |
| InChI | InChI=1S/C28H44O3S.C6H16N2/c1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2;1-3-4-5(2)6(7)8/h17-18,20,22-23H,3-16,19,21H2,1-2H3,(H,29,30,31);5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | OVPKENWPOZIWKF-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|