C56H88O9S3 — CID 161462295
3,4-di(nonyl)naphthalene-1,2-disulfonic acid;2,3-di(nonyl)naphthalene-1-sulfonic acid (PubChem CID 161462295) has the molecular formula C56H88O9S3 and a molecular weight of 1001.51 g/mol. Its IUPAC name is 3,4-di(nonyl)naphthalene-1,2-disulfonic acid;2,3-di(nonyl)naphthalene-1-sulfonic acid.
| Compound Name | 3,4-di(nonyl)naphthalene-1,2-disulfonic acid;2,3-di(nonyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 161462295 |
| Molecular Formula | C56H88O9S3 |
| Molecular Weight | 1001.51 g/mol |
| Exact Mass | 1000.56 |
| IUPAC Name | 3,4-di(nonyl)naphthalene-1,2-disulfonic acid;2,3-di(nonyl)naphthalene-1-sulfonic acid |
| SMILES | CCCCCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCCC.CCCCCCCCCc1cc2ccccc2c(S(=O)(=O)O)c1CCCCCCCCC |
| InChI | InChI=1S/C28H44O6S2.C28H44O3S/c1-3-5-7-9-11-13-15-19-23-24-20-17-18-22-26(24)28(36(32,33)34)27(35(29,30)31)25(23)21-16-14-12-10-8-6-4-2;1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2/h17-18,20,22H,3-16,19,21H2,1-2H3,(H,29,30,31)(H,32,33,34);17-18,20,22-23H,3-16,19,21H2,1-2H3,(H,29,30,31) |
| InChIKey | WBYYZOJDJBZHEM-UHFFFAOYSA-N |
| XLogP | 16.59 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.51 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|