C36H60O3S — CID 150689827
2,3-di(nonyl)-4-octylnaphthalene-1-sulfonic acid (PubChem CID 150689827) has the molecular formula C36H60O3S and a molecular weight of 572.94 g/mol. Its IUPAC name is 2,3-di(nonyl)-4-octylnaphthalene-1-sulfonic acid.
| Compound Name | 2,3-di(nonyl)-4-octylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 150689827 |
| Molecular Formula | C36H60O3S |
| Molecular Weight | 572.94 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | 2,3-di(nonyl)-4-octylnaphthalene-1-sulfonic acid |
| SMILES | CCCCCCCCCc1c(CCCCCCCCC)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCC |
| InChI | InChI=1S/C36H60O3S/c1-4-7-10-13-16-19-22-27-32-31(26-21-18-15-12-9-6-3)33-28-24-25-30-35(33)36(40(37,38)39)34(32)29-23-20-17-14-11-8-5-2/h24-25,28,30H,4-23,26-27,29H2,1-3H3,(H,37,38,39) |
| InChIKey | JJQJPPCBMZGJHU-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.94 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|