C29H46O4S — CID 20574290
2-methoxy-3,4-di(nonyl)naphthalene-1-sulfonic acid (PubChem CID 20574290) has the molecular formula C29H46O4S and a molecular weight of 490.75 g/mol. Its IUPAC name is 2-methoxy-3,4-di(nonyl)naphthalene-1-sulfonic acid.
| Compound Name | 2-methoxy-3,4-di(nonyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 20574290 |
| Molecular Formula | C29H46O4S |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 2-methoxy-3,4-di(nonyl)naphthalene-1-sulfonic acid |
| SMILES | CCCCCCCCCc1c(OC)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCCC |
| InChI | InChI=1S/C29H46O4S/c1-4-6-8-10-12-14-16-20-24-25-21-18-19-23-27(25)29(34(30,31)32)28(33-3)26(24)22-17-15-13-11-9-7-5-2/h18-19,21,23H,4-17,20,22H2,1-3H3,(H,30,31,32) |
| InChIKey | RLUODFCHBSGRIG-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|