C20H29NO6S2 — CID 163283825
4-amino-3-decylnaphthalene-1,2-disulfonic acid (PubChem CID 163283825) has the molecular formula C20H29NO6S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 4-amino-3-decylnaphthalene-1,2-disulfonic acid.
| Compound Name | 4-amino-3-decylnaphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 163283825 |
| Molecular Formula | C20H29NO6S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-amino-3-decylnaphthalene-1,2-disulfonic acid |
| SMILES | CCCCCCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1N |
| InChI | InChI=1S/C20H29NO6S2/c1-2-3-4-5-6-7-8-9-14-17-18(21)15-12-10-11-13-16(15)19(28(22,23)24)20(17)29(25,26)27/h10-13H,2-9,14,21H2,1H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | ADEMVVHMTVJZNQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|