C26H40O4S — CID 130237528
formaldehyde;2,3,4-tripentylnaphthalene-1-sulfonic acid (PubChem CID 130237528) has the molecular formula C26H40O4S and a molecular weight of 448.67 g/mol. Its IUPAC name is formaldehyde;2,3,4-tripentylnaphthalene-1-sulfonic acid.
| Compound Name | formaldehyde;2,3,4-tripentylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 130237528 |
| Molecular Formula | C26H40O4S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | formaldehyde;2,3,4-tripentylnaphthalene-1-sulfonic acid |
| SMILES | C=O.CCCCCc1c(CCCCC)c(S(=O)(=O)O)c2ccccc2c1CCCCC |
| InChI | InChI=1S/C25H38O3S.CH2O/c1-4-7-10-15-20-21(16-11-8-5-2)23(18-12-9-6-3)25(29(26,27)28)24-19-14-13-17-22(20)24;1-2/h13-14,17,19H,4-12,15-16,18H2,1-3H3,(H,26,27,28);1H2 |
| InChIKey | FQPGBOZWZJYEKZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|