C41H69NaO4S — CID 122612210
sodium;formaldehyde;2,3,4-tris-decylnaphthalene-1-sulfonate (PubChem CID 122612210) has the molecular formula C41H69NaO4S and a molecular weight of 681.06 g/mol. Its IUPAC name is sodium;formaldehyde;2,3,4-tris-decylnaphthalene-1-sulfonate.
| Compound Name | sodium;formaldehyde;2,3,4-tris-decylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 122612210 |
| Molecular Formula | C41H69NaO4S |
| Molecular Weight | 681.06 g/mol |
| Exact Mass | 680.48 |
| IUPAC Name | sodium;formaldehyde;2,3,4-tris-decylnaphthalene-1-sulfonate |
| SMILES | C=O.CCCCCCCCCCc1c(CCCCCCCCCC)c(S(=O)(=O)[O-])c2ccccc2c1CCCCCCCCCC.[Na+] |
| InChI | InChI=1S/C40H68O3S.CH2O.Na/c1-4-7-10-13-16-19-22-25-30-35-36(31-26-23-20-17-14-11-8-5-2)38(33-27-24-21-18-15-12-9-6-3)40(44(41,42)43)39-34-29-28-32-37(35)39;1-2;/h28-29,32,34H,4-27,30-31,33H2,1-3H3,(H,41,42,43);1H2;/q;;+1/p-1 |
| InChIKey | RZGMBEGPUYOBES-UHFFFAOYSA-M |
| XLogP | 9.61 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.06 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|