C28H42Na2O6S2 — CID 6455143
disodium;3,4-bis(7-methyloctyl)naphthalene-1,2-disulfonate (PubChem CID 6455143) has the molecular formula C28H42Na2O6S2 and a molecular weight of 584.75 g/mol. Its IUPAC name is disodium;3,4-bis(7-methyloctyl)naphthalene-1,2-disulfonate.
| Compound Name | disodium;3,4-bis(7-methyloctyl)naphthalene-1,2-disulfonate |
|---|---|
| PubChem CID | 6455143 |
| Molecular Formula | C28H42Na2O6S2 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | disodium;3,4-bis(7-methyloctyl)naphthalene-1,2-disulfonate |
| SMILES | CC(C)CCCCCCc1c(S(=O)(=O)[O-])c(S(=O)(=O)[O-])c2ccccc2c1CCCCCCC(C)C.[Na+].[Na+] |
| InChI | InChI=1S/C28H44O6S2.2Na/c1-21(2)15-9-5-7-11-17-23-24-18-13-14-20-26(24)28(36(32,33)34)27(35(29,30)31)25(23)19-12-8-6-10-16-22(3)4;;/h13-14,18,20-22H,5-12,15-17,19H2,1-4H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2 |
| InChIKey | FWELJFNYYIQXFG-UHFFFAOYSA-L |
| XLogP | 0.95 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|