C16H19KO3S — CID 166707046
potassium 2-(4-methylpentyl)naphthalene-1-sulfonate (PubChem CID 166707046) has the molecular formula C16H19KO3S and a molecular weight of 330.49 g/mol. Its IUPAC name is potassium 2-(4-methylpentyl)naphthalene-1-sulfonate.
| Compound Name | potassium 2-(4-methylpentyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 166707046 |
| Molecular Formula | C16H19KO3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | potassium 2-(4-methylpentyl)naphthalene-1-sulfonate |
| SMILES | CC(C)CCCc1ccc2ccccc2c1S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C16H20O3S.K/c1-12(2)6-5-8-14-11-10-13-7-3-4-9-15(13)16(14)20(17,18)19;/h3-4,7,9-12H,5-6,8H2,1-2H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | OXYONXMACIDZHS-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|