C28H30CuO6S2 — CID 22368607
copper bis(2-butylnaphthalene-1-sulfonate) (PubChem CID 22368607) has the molecular formula C28H30CuO6S2 and a molecular weight of 590.22 g/mol. Its IUPAC name is copper bis(2-butylnaphthalene-1-sulfonate).
| Compound Name | copper bis(2-butylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 22368607 |
| Molecular Formula | C28H30CuO6S2 |
| Molecular Weight | 590.22 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | copper bis(2-butylnaphthalene-1-sulfonate) |
| SMILES | CCCCc1ccc2ccccc2c1S(=O)(=O)[O-].CCCCc1ccc2ccccc2c1S(=O)(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C14H16O3S.Cu/c2*1-2-3-6-12-10-9-11-7-4-5-8-13(11)14(12)18(15,16)17;/h2*4-5,7-10H,2-3,6H2,1H3,(H,15,16,17);/q;;+2/p-2 |
| InChIKey | RBTDECWQUPZHGP-UHFFFAOYSA-L |
| XLogP | 6.17 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.22 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|